C43H44F3N3O6 — CID 131990486
[4-[3-[4-[1-[4-(anilinomethyl)phenyl]-4-ethyl-2,5-dioxopyrrolidin-3-yl]butyl]-4-ethyl-2-hydroxy-5-oxopyrrolidin-1-yl]phenyl] 4-(trifluoromethyl)benzoate (PubChem CID 131990486) has the molecular formula C43H44F3N3O6 and a molecular weight of 755.83 g/mol. Its IUPAC name is [4-[3-[4-[1-[4-(anilinomethyl)phenyl]-4-ethyl-2,5-dioxopyrrolidin-3-yl]butyl]-4-ethyl-2-hydroxy-5-oxopyrrolidin-1-yl]phenyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [4-[3-[4-[1-[4-(anilinomethyl)phenyl]-4-ethyl-2,5-dioxopyrrolidin-3-yl]butyl]-4-ethyl-2-hydroxy-5-oxopyrrolidin-1-yl]phenyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 131990486 |
| Molecular Formula | C43H44F3N3O6 |
| Molecular Weight | 755.83 g/mol |
| Exact Mass | 755.32 |
| IUPAC Name | [4-[3-[4-[1-[4-(anilinomethyl)phenyl]-4-ethyl-2,5-dioxopyrrolidin-3-yl]butyl]-4-ethyl-2-hydroxy-5-oxopyrrolidin-1-yl]phenyl] 4-(trifluoromethyl)benzoate |
| SMILES | CCC1C(=O)N(c2ccc(CNc3ccccc3)cc2)C(=O)C1CCCCC1C(CC)C(=O)N(c2ccc(OC(=O)c3ccc(C(F)(F)F)cc3)cc2)C1O |
| InChI | InChI=1S/C43H44F3N3O6/c1-3-34-36(40(52)48(38(34)50)31-20-14-27(15-21-31)26-47-30-10-6-5-7-11-30)12-8-9-13-37-35(4-2)39(51)49(41(37)53)32-22-24-33(25-23-32)55-42(54)28-16-18-29(19-17-28)43(44,45)46/h5-7,10-11,14-25,34-37,41,47,53H,3-4,8-9,12-13,26H2,1-2H3 |
| InChIKey | OLCRJSQSGIJEAE-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.83 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|