C12H21NO — CID 131993309
(3E,6E)-7-methyl-8-nitrosoundeca-3,6-diene (PubChem CID 131993309) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (3E,6E)-7-methyl-8-nitrosoundeca-3,6-diene.
| Compound Name | (3E,6E)-7-methyl-8-nitrosoundeca-3,6-diene |
|---|---|
| PubChem CID | 131993309 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (3E,6E)-7-methyl-8-nitrosoundeca-3,6-diene |
| SMILES | CC/C=C/C/C=C(\C)C(CCC)N=O |
| InChI | InChI=1S/C12H21NO/c1-4-6-7-8-10-11(3)12(13-14)9-5-2/h6-7,10,12H,4-5,8-9H2,1-3H3/b7-6+,11-10+ |
| InChIKey | MPWYBJANQBHREN-MVQNEBOGSA-N |
| XLogP | 4.22 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|