C18H25N5OS — CID 131993793
2-[[(1S)-3-(12-amino-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl)cyclohexyl]-methylamino]acetamide (PubChem CID 131993793) has the molecular formula C18H25N5OS and a molecular weight of 359.50 g/mol. Its IUPAC name is 2-[[(1S)-3-(12-amino-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl)cyclohexyl]-methylamino]acetamide.
| Compound Name | 2-[[(1S)-3-(12-amino-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl)cyclohexyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 131993793 |
| Molecular Formula | C18H25N5OS |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 2-[[(1S)-3-(12-amino-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-3-yl)cyclohexyl]-methylamino]acetamide |
| SMILES | CN(CC(N)=O)[C@H]1CCCC(C2CCc3sc4ncnc(N)c4c32)C1 |
| InChI | InChI=1S/C18H25N5OS/c1-23(8-14(19)24)11-4-2-3-10(7-11)12-5-6-13-15(12)16-17(20)21-9-22-18(16)25-13/h9-12H,2-8H2,1H3,(H2,19,24)(H2,20,21,22)/t10?,11-,12?/m0/s1 |
| InChIKey | CPJQGZUASPMKKM-CXQJBGSLSA-N |
| XLogP | 2.28 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |