C24H29ClN4S — CID 131993872
3-[(3S)-3-[2-(3-chlorophenyl)ethyl-methylamino]cyclohexyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 131993872) has the molecular formula C24H29ClN4S and a molecular weight of 441.04 g/mol. Its IUPAC name is 3-[(3S)-3-[2-(3-chlorophenyl)ethyl-methylamino]cyclohexyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | 3-[(3S)-3-[2-(3-chlorophenyl)ethyl-methylamino]cyclohexyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 131993872 |
| Molecular Formula | C24H29ClN4S |
| Molecular Weight | 441.04 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 3-[(3S)-3-[2-(3-chlorophenyl)ethyl-methylamino]cyclohexyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | CN(CCc1cccc(Cl)c1)[C@H]1CCCC(C2CCc3sc4ncnc(N)c4c32)C1 |
| InChI | InChI=1S/C24H29ClN4S/c1-29(11-10-15-4-2-6-17(25)12-15)18-7-3-5-16(13-18)19-8-9-20-21(19)22-23(26)27-14-28-24(22)30-20/h2,4,6,12,14,16,18-19H,3,5,7-11,13H2,1H3,(H2,26,27,28)/t16?,18-,19?/m0/s1 |
| InChIKey | SARHBQFHZGSYCX-AVAKVYKDSA-N |
| XLogP | 5.69 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.04 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |