C21H30N4OS — CID 131993679
3-[(3S)-3-[methyl(oxan-4-yl)amino]cyclohexyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 131993679) has the molecular formula C21H30N4OS and a molecular weight of 386.57 g/mol. Its IUPAC name is 3-[(3S)-3-[methyl(oxan-4-yl)amino]cyclohexyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | 3-[(3S)-3-[methyl(oxan-4-yl)amino]cyclohexyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 131993679 |
| Molecular Formula | C21H30N4OS |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 3-[(3S)-3-[methyl(oxan-4-yl)amino]cyclohexyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | CN(C1CCOCC1)[C@H]1CCCC(C2CCc3sc4ncnc(N)c4c32)C1 |
| InChI | InChI=1S/C21H30N4OS/c1-25(14-7-9-26-10-8-14)15-4-2-3-13(11-15)16-5-6-17-18(16)19-20(22)23-12-24-21(19)27-17/h12-16H,2-11H2,1H3,(H2,22,23,24)/t13?,15-,16?/m0/s1 |
| InChIKey | NWUQYQBZNAXCON-SIWZUTFBSA-N |
| XLogP | 3.97 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |