C20H30N4S — CID 131993792
3-[(3S)-3-[methyl(2-methylpropyl)amino]cyclohexyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 131993792) has the molecular formula C20H30N4S and a molecular weight of 358.56 g/mol. Its IUPAC name is 3-[(3S)-3-[methyl(2-methylpropyl)amino]cyclohexyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | 3-[(3S)-3-[methyl(2-methylpropyl)amino]cyclohexyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 131993792 |
| Molecular Formula | C20H30N4S |
| Molecular Weight | 358.56 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 3-[(3S)-3-[methyl(2-methylpropyl)amino]cyclohexyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | CC(C)CN(C)[C@H]1CCCC(C2CCc3sc4ncnc(N)c4c32)C1 |
| InChI | InChI=1S/C20H30N4S/c1-12(2)10-24(3)14-6-4-5-13(9-14)15-7-8-16-17(15)18-19(21)22-11-23-20(18)25-16/h11-15H,4-10H2,1-3H3,(H2,21,22,23)/t13?,14-,15?/m0/s1 |
| InChIKey | ZUYXHJSRLUNEQE-SLTAFYQDSA-N |
| XLogP | 4.45 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |