C12H13N3O4 — CID 13241128
5-[4-(dimethylamino)phenyl]-5-hydroxy-1,3-diazinane-2,4,6-trione (PubChem CID 13241128) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 5-[4-(dimethylamino)phenyl]-5-hydroxy-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[4-(dimethylamino)phenyl]-5-hydroxy-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 13241128 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 5-[4-(dimethylamino)phenyl]-5-hydroxy-1,3-diazinane-2,4,6-trione |
| SMILES | CN(C)c1ccc(C2(O)C(=O)NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C12H13N3O4/c1-15(2)8-5-3-7(4-6-8)12(19)9(16)13-11(18)14-10(12)17/h3-6,19H,1-2H3,(H2,13,14,16,17,18) |
| InChIKey | UEUAKXYPAREUPY-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|