C17H18N4O2 — CID 143510584
(5S)-5-[4-[4-[amino(methyl)amino]phenyl]phenyl]-5-methylimidazolidine-2,4-dione (PubChem CID 143510584) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is (5S)-5-[4-[4-[amino(methyl)amino]phenyl]phenyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-[4-[4-[amino(methyl)amino]phenyl]phenyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143510584 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (5S)-5-[4-[4-[amino(methyl)amino]phenyl]phenyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CN(N)c1ccc(-c2ccc([C@]3(C)NC(=O)NC3=O)cc2)cc1 |
| InChI | InChI=1S/C17H18N4O2/c1-17(15(22)19-16(23)20-17)13-7-3-11(4-8-13)12-5-9-14(10-6-12)21(2)18/h3-10H,18H2,1-2H3,(H2,19,20,22,23)/t17-/m0/s1 |
| InChIKey | AFTBUTBUZLKHJU-KRWDZBQOSA-N |
| XLogP | 1.72 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|