C29H52O5Si — CID 132500002
ditert-butyl (Z)-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3-prop-2-enylbut-2-enedioate (PubChem CID 132500002) has the molecular formula C29H52O5Si and a molecular weight of 508.82 g/mol. Its IUPAC name is ditert-butyl (Z)-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3-prop-2-enylbut-2-enedioate.
| Compound Name | ditert-butyl (Z)-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3-prop-2-enylbut-2-enedioate |
|---|---|
| PubChem CID | 132500002 |
| Molecular Formula | C29H52O5Si |
| Molecular Weight | 508.82 g/mol |
| Exact Mass | 508.36 |
| IUPAC Name | ditert-butyl (Z)-2-[(E)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-3-prop-2-enylbut-2-enedioate |
| SMILES | C=CC/C(C(=O)OC(C)(C)C)=C(\C=C\C(CCCCC)O[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H52O5Si/c1-14-16-17-19-22(34-35(12,13)29(9,10)11)20-21-24(26(31)33-28(6,7)8)23(18-15-2)25(30)32-27(3,4)5/h15,20-22H,2,14,16-19H2,1,3-13H3/b21-20+,24-23- |
| InChIKey | SATMENGSPDHMNN-HHYPSQHASA-N |
| XLogP | 8.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.82 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|