About CID 132501591
CID 132501591 (PubChem CID 132501591) has the molecular formula C9H11ClFNPd-
and a molecular weight of 294.06 g/mol.
Molecular Properties
| Compound Name | CID 132501591 |
| PubChem CID | 132501591 |
| Molecular Formula | C9H11ClFNPd- |
| Molecular Weight | 294.06 g/mol |
| Exact Mass | 292.96 |
| IUPAC Name | — |
| SMILES | CN(C)Cc1[c]cccc1F.[Cl-].[Pd] |
| InChI | InChI=1S/C9H11FN.ClH.Pd/c1-11(2)7-8-5-3-4-6-9(8)10;;/h3-4,6H,7H2,1-2H3;1H;/p-1 |
| InChIKey | KAMJBVHNRWEHAQ-UHFFFAOYSA-M |
| XLogP | -1.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.06 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 132501591 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 132501591?
The IUPAC name of CID 132501591 (CID 132501591) is not available.
What is the SMILES notation for CID 132501591?
The canonical SMILES for CID 132501591 is CN(C)Cc1[c]cccc1F.[Cl-].[Pd].
What is the InChIKey of CID 132501591?
The InChIKey is KAMJBVHNRWEHAQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H11FN.ClH.Pd/c1-11(2)7-8-5-3-4-6-9(8)10;;/h3-4,6H,7H2,1-2H3;1H;/p-1.
What are the key properties of CID 132501591?
CID 132501591 has a molecular weight of 294.06 g/mol, XLogP of -1.31, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 132501591 is sourced from PubChem (CID 132501591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).