C9H11ClFNPd- — CID 132501591
CID 132501591 (PubChem CID 132501591) has the molecular formula C9H11ClFNPd- and a molecular weight of 294.06 g/mol.
| Compound Name | CID 132501591 |
|---|---|
| PubChem CID | 132501591 |
| Molecular Formula | C9H11ClFNPd- |
| Molecular Weight | 294.06 g/mol |
| Exact Mass | 292.96 |
| IUPAC Name | — |
| SMILES | CN(C)Cc1[c]cccc1F.[Cl-].[Pd] |
| InChI | InChI=1S/C9H11FN.ClH.Pd/c1-11(2)7-8-5-3-4-6-9(8)10;;/h3-4,6H,7H2,1-2H3;1H;/p-1 |
| InChIKey | KAMJBVHNRWEHAQ-UHFFFAOYSA-M |
| XLogP | -1.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.06 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |