C26H24N4O2 — CID 132504164
(E)-2-[3-[4-(dimethylamino)phenyl]-2-phenyl-3H-1,2,4-oxadiazol-5-yl]-3-(4-methoxyphenyl)prop-2-enenitrile (PubChem CID 132504164) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is (E)-2-[3-[4-(dimethylamino)phenyl]-2-phenyl-3H-1,2,4-oxadiazol-5-yl]-3-(4-methoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-[3-[4-(dimethylamino)phenyl]-2-phenyl-3H-1,2,4-oxadiazol-5-yl]-3-(4-methoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 132504164 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (E)-2-[3-[4-(dimethylamino)phenyl]-2-phenyl-3H-1,2,4-oxadiazol-5-yl]-3-(4-methoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(/C=C(\C#N)C2=NC(c3ccc(N(C)C)cc3)N(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C26H24N4O2/c1-29(2)22-13-11-20(12-14-22)25-28-26(32-30(25)23-7-5-4-6-8-23)21(18-27)17-19-9-15-24(31-3)16-10-19/h4-17,25H,1-3H3/b21-17+ |
| InChIKey | PJAUNAPQRYNDEU-HEHNFIMWSA-N |
| XLogP | 5.22 |
| TPSA | 61.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|