C16H15N3O — CID 132514560
1-(5-methoxy-2,3-dihydro-1H-inden-1-yl)benzotriazole (PubChem CID 132514560) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 1-(5-methoxy-2,3-dihydro-1H-inden-1-yl)benzotriazole.
| Compound Name | 1-(5-methoxy-2,3-dihydro-1H-inden-1-yl)benzotriazole |
|---|---|
| PubChem CID | 132514560 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 1-(5-methoxy-2,3-dihydro-1H-inden-1-yl)benzotriazole |
| SMILES | COc1ccc2c(c1)CCC2n1nnc2ccccc21 |
| InChI | InChI=1S/C16H15N3O/c1-20-12-7-8-13-11(10-12)6-9-15(13)19-16-5-3-2-4-14(16)17-18-19/h2-5,7-8,10,15H,6,9H2,1H3 |
| InChIKey | CKPBYBNGYNHYPD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |