C15H12O3 — CID 132516042
(1R,2S,11R,12S)-15-hydroxytetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene-3,10-dione (PubChem CID 132516042) has the molecular formula C15H12O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is (1R,2S,11R,12S)-15-hydroxytetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene-3,10-dione.
| Compound Name | (1R,2S,11R,12S)-15-hydroxytetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene-3,10-dione |
|---|---|
| PubChem CID | 132516042 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (1R,2S,11R,12S)-15-hydroxytetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,13-tetraene-3,10-dione |
| SMILES | O=C1c2ccccc2C(=O)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1O |
| InChI | InChI=1S/C15H12O3/c16-13-9-5-6-10(13)12-11(9)14(17)7-3-1-2-4-8(7)15(12)18/h1-6,9-13,16H/t9-,10+,11+,12-,13? |
| InChIKey | NAPXHPVHLMPCEM-IQYBISDWSA-N |
| XLogP | 1.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|