C18H14N2O3 — CID 132517578
N-[1-(1,3-dioxoisoindol-2-yl)prop-2-enyl]benzamide (PubChem CID 132517578) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is N-[1-(1,3-dioxoisoindol-2-yl)prop-2-enyl]benzamide.
| Compound Name | N-[1-(1,3-dioxoisoindol-2-yl)prop-2-enyl]benzamide |
|---|---|
| PubChem CID | 132517578 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-[1-(1,3-dioxoisoindol-2-yl)prop-2-enyl]benzamide |
| SMILES | C=CC(NC(=O)c1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H14N2O3/c1-2-15(19-16(21)12-8-4-3-5-9-12)20-17(22)13-10-6-7-11-14(13)18(20)23/h2-11,15H,1H2,(H,19,21) |
| InChIKey | RIWYOVYZBINBIO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|