C20H31NO3 — CID 132518526
[1-(cyclohexylamino)-3-(4-methylcyclohex-3-en-1-yl)-1-oxobutan-2-yl] prop-2-enoate (PubChem CID 132518526) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is [1-(cyclohexylamino)-3-(4-methylcyclohex-3-en-1-yl)-1-oxobutan-2-yl] prop-2-enoate.
| Compound Name | [1-(cyclohexylamino)-3-(4-methylcyclohex-3-en-1-yl)-1-oxobutan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 132518526 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | [1-(cyclohexylamino)-3-(4-methylcyclohex-3-en-1-yl)-1-oxobutan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C(=O)NC1CCCCC1)C(C)C1CC=C(C)CC1 |
| InChI | InChI=1S/C20H31NO3/c1-4-18(22)24-19(15(3)16-12-10-14(2)11-13-16)20(23)21-17-8-6-5-7-9-17/h4,10,15-17,19H,1,5-9,11-13H2,2-3H3,(H,21,23) |
| InChIKey | XYSQWDGGNYYPFX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|