C18H27NO5 — CID 132518525
[1-[(2-ethoxy-2-oxoethyl)amino]-3-(4-methylcyclohex-3-en-1-yl)-1-oxobutan-2-yl] prop-2-enoate (PubChem CID 132518525) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is [1-[(2-ethoxy-2-oxoethyl)amino]-3-(4-methylcyclohex-3-en-1-yl)-1-oxobutan-2-yl] prop-2-enoate.
| Compound Name | [1-[(2-ethoxy-2-oxoethyl)amino]-3-(4-methylcyclohex-3-en-1-yl)-1-oxobutan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 132518525 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | [1-[(2-ethoxy-2-oxoethyl)amino]-3-(4-methylcyclohex-3-en-1-yl)-1-oxobutan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C(=O)NCC(=O)OCC)C(C)C1CC=C(C)CC1 |
| InChI | InChI=1S/C18H27NO5/c1-5-15(20)24-17(18(22)19-11-16(21)23-6-2)13(4)14-9-7-12(3)8-10-14/h5,7,13-14,17H,1,6,8-11H2,2-4H3,(H,19,22) |
| InChIKey | JVSYLHAJFYTHSC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|