C27H22F34N+ — CID 132520815
1,1-bis(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)piperidin-1-ium (PubChem CID 132520815) has the molecular formula C27H22F34N+ and a molecular weight of 1006.41 g/mol. Its IUPAC name is 1,1-bis(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)piperidin-1-ium.
| Compound Name | 1,1-bis(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)piperidin-1-ium |
|---|---|
| PubChem CID | 132520815 |
| Molecular Formula | C27H22F34N+ |
| Molecular Weight | 1006.41 g/mol |
| Exact Mass | 1006.12 |
| IUPAC Name | 1,1-bis(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)piperidin-1-ium |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC[N+]1(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C27H22F34N/c28-12(29,14(32,33)16(36,37)18(40,41)20(44,45)22(48,49)24(52,53)26(56,57)58)6-4-10-62(8-2-1-3-9-62)11-5-7-13(30,31)15(34,35)17(38,39)19(42,43)21(46,47)23(50,51)25(54,55)27(59,60)61/h1-11H2/q+1 |
| InChIKey | WQZXMIZKSHWTAZ-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1006.41 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|