C14H15N3OS — CID 132522668
(5Z)-5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 132522668) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is (5Z)-5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 132522668 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | (5Z)-5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN(C)c1ccc(/C=C/C=C2\NC(=S)NC2=O)cc1 |
| InChI | InChI=1S/C14H15N3OS/c1-17(2)11-8-6-10(7-9-11)4-3-5-12-13(18)16-14(19)15-12/h3-9H,1-2H3,(H2,15,16,18,19)/b4-3+,12-5- |
| InChIKey | OOXOHSMRCVBSDY-UBXZVMTISA-N |
| XLogP | 1.65 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|