C14H20N6O4 — CID 132522881
6-[2-(6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-ylmethoxy)ethoxymethyl]-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine (PubChem CID 132522881) has the molecular formula C14H20N6O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 6-[2-(6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-ylmethoxy)ethoxymethyl]-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine.
| Compound Name | 6-[2-(6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-ylmethoxy)ethoxymethyl]-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 132522881 |
| Molecular Formula | C14H20N6O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 6-[2-(6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-ylmethoxy)ethoxymethyl]-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazine |
| SMILES | c1nnn2c1COC(COCCOCC1Cn3nncc3CO1)C2 |
| InChI | InChI=1S/C14H20N6O4/c1(21-9-13-5-19-11(7-23-13)3-15-17-19)2-22-10-14-6-20-12(8-24-14)4-16-18-20/h3-4,13-14H,1-2,5-10H2 |
| InChIKey | FKJGOVICHVSYSW-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|