C16H27ClO7 — CID 132524982
3-[(2S,3R,4S,4aS,6R,8S,8aS)-8-chloro-2,3,4-trimethoxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]propyl acetate (PubChem CID 132524982) has the molecular formula C16H27ClO7 and a molecular weight of 366.84 g/mol. Its IUPAC name is 3-[(2S,3R,4S,4aS,6R,8S,8aS)-8-chloro-2,3,4-trimethoxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]propyl acetate.
| Compound Name | 3-[(2S,3R,4S,4aS,6R,8S,8aS)-8-chloro-2,3,4-trimethoxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]propyl acetate |
|---|---|
| PubChem CID | 132524982 |
| Molecular Formula | C16H27ClO7 |
| Molecular Weight | 366.84 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 3-[(2S,3R,4S,4aS,6R,8S,8aS)-8-chloro-2,3,4-trimethoxy-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]propyl acetate |
| SMILES | CO[C@H]1O[C@H]2[C@@H](O[C@H](CCCOC(C)=O)C[C@@H]2Cl)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C16H27ClO7/c1-9(18)22-7-5-6-10-8-11(17)12-14(23-10)13(19-2)15(20-3)16(21-4)24-12/h10-16H,5-8H2,1-4H3/t10-,11+,12-,13+,14-,15-,16+/m1/s1 |
| InChIKey | ZIRYSBUBDWJIRG-ORKIIUGYSA-N |
| XLogP | 1.50 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.84 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|