C15H24O4 — CID 132526749
1-[(1R,2R,4aR,5R,6S,8aS)-2,5-dihydroxy-2,6-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-3-hydroxypropan-1-one (PubChem CID 132526749) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 1-[(1R,2R,4aR,5R,6S,8aS)-2,5-dihydroxy-2,6-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-3-hydroxypropan-1-one.
| Compound Name | 1-[(1R,2R,4aR,5R,6S,8aS)-2,5-dihydroxy-2,6-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-3-hydroxypropan-1-one |
|---|---|
| PubChem CID | 132526749 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 1-[(1R,2R,4aR,5R,6S,8aS)-2,5-dihydroxy-2,6-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-naphthalen-1-yl]-3-hydroxypropan-1-one |
| SMILES | C[C@H]1CC[C@H]2[C@@H](C=C[C@@](C)(O)[C@@H]2C(=O)CCO)[C@@H]1O |
| InChI | InChI=1S/C15H24O4/c1-9-3-4-10-11(14(9)18)5-7-15(2,19)13(10)12(17)6-8-16/h5,7,9-11,13-14,16,18-19H,3-4,6,8H2,1-2H3/t9-,10-,11+,13-,14+,15+/m0/s1 |
| InChIKey | MJFPXTRAOBFCPD-UBHGWVTLSA-N |
| XLogP | 0.90 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|