C25H21NO2 — CID 132527261
methyl (1R)-1-phenyl-1-(2-phenylethynyl)-3,4-dihydroisoquinoline-2-carboxylate (PubChem CID 132527261) has the molecular formula C25H21NO2 and a molecular weight of 367.45 g/mol. Its IUPAC name is methyl (1R)-1-phenyl-1-(2-phenylethynyl)-3,4-dihydroisoquinoline-2-carboxylate.
| Compound Name | methyl (1R)-1-phenyl-1-(2-phenylethynyl)-3,4-dihydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 132527261 |
| Molecular Formula | C25H21NO2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | methyl (1R)-1-phenyl-1-(2-phenylethynyl)-3,4-dihydroisoquinoline-2-carboxylate |
| SMILES | COC(=O)N1CCc2ccccc2[C@]1(C#Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H21NO2/c1-28-24(27)26-19-17-21-12-8-9-15-23(21)25(26,22-13-6-3-7-14-22)18-16-20-10-4-2-5-11-20/h2-15H,17,19H2,1H3/t25-/m0/s1 |
| InChIKey | DFKUPSRVLBNEIL-VWLOTQADSA-N |
| XLogP | 4.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|