C17H27NO4 — CID 132532548
tert-butyl (4S)-2,2-dimethyl-4-[(4-oxocyclohexen-1-yl)methyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 132532548) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is tert-butyl (4S)-2,2-dimethyl-4-[(4-oxocyclohexen-1-yl)methyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-2,2-dimethyl-4-[(4-oxocyclohexen-1-yl)methyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 132532548 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | tert-butyl (4S)-2,2-dimethyl-4-[(4-oxocyclohexen-1-yl)methyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CC2=CCC(=O)CC2)COC1(C)C |
| InChI | InChI=1S/C17H27NO4/c1-16(2,3)22-15(20)18-13(11-21-17(18,4)5)10-12-6-8-14(19)9-7-12/h6,13H,7-11H2,1-5H3/t13-/m0/s1 |
| InChIKey | CKUZVLFGZWJQPE-ZDUSSCGKSA-N |
| XLogP | 3.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|