C13H16Cl3N3O4 — CID 132534053
diethyl 6-(dimethylamino)-2-(trichloromethyl)pyrimidine-4,5-dicarboxylate (PubChem CID 132534053) has the molecular formula C13H16Cl3N3O4 and a molecular weight of 384.65 g/mol. Its IUPAC name is diethyl 6-(dimethylamino)-2-(trichloromethyl)pyrimidine-4,5-dicarboxylate.
| Compound Name | diethyl 6-(dimethylamino)-2-(trichloromethyl)pyrimidine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 132534053 |
| Molecular Formula | C13H16Cl3N3O4 |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | diethyl 6-(dimethylamino)-2-(trichloromethyl)pyrimidine-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1nc(C(Cl)(Cl)Cl)nc(N(C)C)c1C(=O)OCC |
| InChI | InChI=1S/C13H16Cl3N3O4/c1-5-22-10(20)7-8(11(21)23-6-2)17-12(13(14,15)16)18-9(7)19(3)4/h5-6H2,1-4H3 |
| InChIKey | ILUFXFXDJBGXQO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|