C14H16BrNO7 — CID 71567600
triethyl 6-bromo-5-hydroxypyridine-2,3,4-tricarboxylate (PubChem CID 71567600) has the molecular formula C14H16BrNO7 and a molecular weight of 390.19 g/mol. Its IUPAC name is triethyl 6-bromo-5-hydroxypyridine-2,3,4-tricarboxylate.
| Compound Name | triethyl 6-bromo-5-hydroxypyridine-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 71567600 |
| Molecular Formula | C14H16BrNO7 |
| Molecular Weight | 390.19 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | triethyl 6-bromo-5-hydroxypyridine-2,3,4-tricarboxylate |
| SMILES | CCOC(=O)c1nc(Br)c(O)c(C(=O)OCC)c1C(=O)OCC |
| InChI | InChI=1S/C14H16BrNO7/c1-4-21-12(18)7-8(13(19)22-5-2)10(17)11(15)16-9(7)14(20)23-6-3/h17H,4-6H2,1-3H3 |
| InChIKey | AHOCDYZUMWMSSD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.19 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|