C11H12Cl3N3O4 — CID 132534051
diethyl 6-amino-2-(trichloromethyl)pyrimidine-4,5-dicarboxylate (PubChem CID 132534051) has the molecular formula C11H12Cl3N3O4 and a molecular weight of 356.59 g/mol. Its IUPAC name is diethyl 6-amino-2-(trichloromethyl)pyrimidine-4,5-dicarboxylate.
| Compound Name | diethyl 6-amino-2-(trichloromethyl)pyrimidine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 132534051 |
| Molecular Formula | C11H12Cl3N3O4 |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | diethyl 6-amino-2-(trichloromethyl)pyrimidine-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1nc(C(Cl)(Cl)Cl)nc(N)c1C(=O)OCC |
| InChI | InChI=1S/C11H12Cl3N3O4/c1-3-20-8(18)5-6(9(19)21-4-2)16-10(11(12,13)14)17-7(5)15/h3-4H2,1-2H3,(H2,15,16,17) |
| InChIKey | DXQVLEMSJHJTEV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|