C22H22Br2N2O10Se — CID 122389010
diethyl 2-bromo-6-[[6-bromo-4,5-bis(ethoxycarbonyl)-3-hydroxy-2-pyridinyl]selanyl]-5-hydroxypyridine-3,4-dicarboxylate (PubChem CID 122389010) has the molecular formula C22H22Br2N2O10Se and a molecular weight of 713.19 g/mol. Its IUPAC name is diethyl 2-bromo-6-[[6-bromo-4,5-bis(ethoxycarbonyl)-3-hydroxy-2-pyridinyl]selanyl]-5-hydroxypyridine-3,4-dicarboxylate.
| Compound Name | diethyl 2-bromo-6-[[6-bromo-4,5-bis(ethoxycarbonyl)-3-hydroxy-2-pyridinyl]selanyl]-5-hydroxypyridine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 122389010 |
| Molecular Formula | C22H22Br2N2O10Se |
| Molecular Weight | 713.19 g/mol |
| Exact Mass | 711.88 |
| IUPAC Name | diethyl 2-bromo-6-[[6-bromo-4,5-bis(ethoxycarbonyl)-3-hydroxy-2-pyridinyl]selanyl]-5-hydroxypyridine-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(Br)nc([Se]c2nc(Br)c(C(=O)OCC)c(C(=O)OCC)c2O)c(O)c1C(=O)OCC |
| InChI | InChI=1S/C22H22Br2N2O10Se/c1-5-33-19(29)9-11(21(31)35-7-3)15(23)25-17(13(9)27)37-18-14(28)10(20(30)34-6-2)12(16(24)26-18)22(32)36-8-4/h27-28H,5-8H2,1-4H3 |
| InChIKey | DXHIWBVNUTZLFH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 171.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|