C19H19FO4S — CID 132534074
methyl 2-[(E)-3-butoxy-3-oxoprop-1-enyl]-4-(4-fluorophenyl)thiophene-3-carboxylate (PubChem CID 132534074) has the molecular formula C19H19FO4S and a molecular weight of 362.42 g/mol. Its IUPAC name is methyl 2-[(E)-3-butoxy-3-oxoprop-1-enyl]-4-(4-fluorophenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[(E)-3-butoxy-3-oxoprop-1-enyl]-4-(4-fluorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 132534074 |
| Molecular Formula | C19H19FO4S |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | methyl 2-[(E)-3-butoxy-3-oxoprop-1-enyl]-4-(4-fluorophenyl)thiophene-3-carboxylate |
| SMILES | CCCCOC(=O)/C=C/c1scc(-c2ccc(F)cc2)c1C(=O)OC |
| InChI | InChI=1S/C19H19FO4S/c1-3-4-11-24-17(21)10-9-16-18(19(22)23-2)15(12-25-16)13-5-7-14(20)8-6-13/h5-10,12H,3-4,11H2,1-2H3/b10-9+ |
| InChIKey | VGEYYQYBFPUJNW-MDZDMXLPSA-N |
| XLogP | 4.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|