C16H31NO3 — CID 132534346
[(Z,3R)-4-hydroxy-2,5-dimethylhept-4-en-3-yl] N,N-di(propan-2-yl)carbamate (PubChem CID 132534346) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is [(Z,3R)-4-hydroxy-2,5-dimethylhept-4-en-3-yl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(Z,3R)-4-hydroxy-2,5-dimethylhept-4-en-3-yl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 132534346 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | [(Z,3R)-4-hydroxy-2,5-dimethylhept-4-en-3-yl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC/C(C)=C(\O)[C@H](OC(=O)N(C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C16H31NO3/c1-9-13(8)14(18)15(10(2)3)20-16(19)17(11(4)5)12(6)7/h10-12,15,18H,9H2,1-8H3/b14-13-/t15-/m1/s1 |
| InChIKey | JUKADRIQBFCGHW-SEWDUPMJSA-N |
| XLogP | 4.51 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|