C21H43NO3Si — CID 132534349
[(E)-2,5-dimethyl-4-trimethylsilyloxynon-4-en-3-yl] N,N-di(propan-2-yl)carbamate (PubChem CID 132534349) has the molecular formula C21H43NO3Si and a molecular weight of 385.67 g/mol. Its IUPAC name is [(E)-2,5-dimethyl-4-trimethylsilyloxynon-4-en-3-yl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(E)-2,5-dimethyl-4-trimethylsilyloxynon-4-en-3-yl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 132534349 |
| Molecular Formula | C21H43NO3Si |
| Molecular Weight | 385.67 g/mol |
| Exact Mass | 385.30 |
| IUPAC Name | [(E)-2,5-dimethyl-4-trimethylsilyloxynon-4-en-3-yl] N,N-di(propan-2-yl)carbamate |
| SMILES | CCCC/C(C)=C(/O[Si](C)(C)C)C(OC(=O)N(C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C21H43NO3Si/c1-12-13-14-18(8)20(25-26(9,10)11)19(15(2)3)24-21(23)22(16(4)5)17(6)7/h15-17,19H,12-14H2,1-11H3/b20-18+ |
| InChIKey | LRQOREBQEPSSPJ-CZIZESTLSA-N |
| XLogP | 6.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.67 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|