About 2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]acetic acid
2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]acetic acid (PubChem CID 132534577) has the molecular formula C10H10N2O5
and a molecular weight of 238.20 g/mol. Its IUPAC name is 2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]acetic acid |
| PubChem CID | 132534577 |
| Molecular Formula | C10H10N2O5 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]acetic acid |
| SMILES | CC(=O)NC1=CC(=O)C(NCC(=O)O)=CC1=O |
| InChI | InChI=1S/C10H10N2O5/c1-5(13)12-7-3-8(14)6(2-9(7)15)11-4-10(16)17/h2-3,11H,4H2,1H3,(H,12,13)(H,16,17) |
| InChIKey | WNYPVNUCWDXFCM-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]acetic acid?
The IUPAC name of 2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]acetic acid (CID 132534577) is 2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]acetic acid.
What is the SMILES notation for 2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]acetic acid?
The canonical SMILES for 2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]acetic acid is CC(=O)NC1=CC(=O)C(NCC(=O)O)=CC1=O.
What is the InChIKey of 2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]acetic acid?
The InChIKey is WNYPVNUCWDXFCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O5/c1-5(13)12-7-3-8(14)6(2-9(7)15)11-4-10(16)17/h2-3,11H,4H2,1H3,(H,12,13)(H,16,17).
What are the key properties of 2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]acetic acid?
2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]acetic acid has a molecular weight of 238.20 g/mol, XLogP of -1.28, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]acetic acid is sourced from PubChem (CID 132534577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).