C17H15FO — CID 132534624
5-fluoro-9-methyl-12-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,13,15-hexaene (PubChem CID 132534624) has the molecular formula C17H15FO and a molecular weight of 254.30 g/mol. Its IUPAC name is 5-fluoro-9-methyl-12-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,13,15-hexaene.
| Compound Name | 5-fluoro-9-methyl-12-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,13,15-hexaene |
|---|---|
| PubChem CID | 132534624 |
| Molecular Formula | C17H15FO |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 5-fluoro-9-methyl-12-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,13,15-hexaene |
| SMILES | CC12CCOc3cccc(c31)-c1ccc(F)cc1C2 |
| InChI | InChI=1S/C17H15FO/c1-17-7-8-19-15-4-2-3-14(16(15)17)13-6-5-12(18)9-11(13)10-17/h2-6,9H,7-8,10H2,1H3 |
| InChIKey | MJDMABGKGSVPCY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |