C29H26NO2P — CID 132535712
(2R,3R)-1-diphenylphosphoryl-2-(4-methoxyphenyl)-3-[(E)-2-phenylethenyl]aziridine (PubChem CID 132535712) has the molecular formula C29H26NO2P and a molecular weight of 451.51 g/mol. Its IUPAC name is (2R,3R)-1-diphenylphosphoryl-2-(4-methoxyphenyl)-3-[(E)-2-phenylethenyl]aziridine.
| Compound Name | (2R,3R)-1-diphenylphosphoryl-2-(4-methoxyphenyl)-3-[(E)-2-phenylethenyl]aziridine |
|---|---|
| PubChem CID | 132535712 |
| Molecular Formula | C29H26NO2P |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | (2R,3R)-1-diphenylphosphoryl-2-(4-methoxyphenyl)-3-[(E)-2-phenylethenyl]aziridine |
| SMILES | COc1ccc([C@@H]2[C@@H](/C=C/c3ccccc3)N2P(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H26NO2P/c1-32-25-20-18-24(19-21-25)29-28(22-17-23-11-5-2-6-12-23)30(29)33(31,26-13-7-3-8-14-26)27-15-9-4-10-16-27/h2-22,28-29H,1H3/b22-17+/t28-,29-,30?/m1/s1 |
| InChIKey | IIJBBTZXXLFWTL-NFHNOTPDSA-N |
| XLogP | 6.06 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|