C25H33NO5 — CID 132537021
diethyl (1S,5S,7R)-3-(cyclohexylmethyl)-4-oxo-7-phenyl-3-azabicyclo[3.2.0]heptane-6,6-dicarboxylate (PubChem CID 132537021) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is diethyl (1S,5S,7R)-3-(cyclohexylmethyl)-4-oxo-7-phenyl-3-azabicyclo[3.2.0]heptane-6,6-dicarboxylate.
| Compound Name | diethyl (1S,5S,7R)-3-(cyclohexylmethyl)-4-oxo-7-phenyl-3-azabicyclo[3.2.0]heptane-6,6-dicarboxylate |
|---|---|
| PubChem CID | 132537021 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | diethyl (1S,5S,7R)-3-(cyclohexylmethyl)-4-oxo-7-phenyl-3-azabicyclo[3.2.0]heptane-6,6-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H]2C(=O)N(CC3CCCCC3)C[C@H]2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H33NO5/c1-3-30-23(28)25(24(29)31-4-2)20(18-13-9-6-10-14-18)19-16-26(22(27)21(19)25)15-17-11-7-5-8-12-17/h6,9-10,13-14,17,19-21H,3-5,7-8,11-12,15-16H2,1-2H3/t19-,20-,21+/m0/s1 |
| InChIKey | WHNHFLLSECNYTM-PCCBWWKXSA-N |
| XLogP | 3.55 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|