C29H43NO7 — CID 101120914
1-O,1-O'-diethyl 3-O-methyl (2S,3S,5R)-2-phenyl-5-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]cyclopentane-1,1,3-tricarboxylate (PubChem CID 101120914) has the molecular formula C29H43NO7 and a molecular weight of 517.66 g/mol. Its IUPAC name is 1-O,1-O'-diethyl 3-O-methyl (2S,3S,5R)-2-phenyl-5-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]cyclopentane-1,1,3-tricarboxylate.
| Compound Name | 1-O,1-O'-diethyl 3-O-methyl (2S,3S,5R)-2-phenyl-5-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]cyclopentane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 101120914 |
| Molecular Formula | C29H43NO7 |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.30 |
| IUPAC Name | 1-O,1-O'-diethyl 3-O-methyl (2S,3S,5R)-2-phenyl-5-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]cyclopentane-1,1,3-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H](CON2C(C)(C)CCCC2(C)C)C[C@H](C(=O)OC)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C29H43NO7/c1-8-35-25(32)29(26(33)36-9-2)21(19-37-30-27(3,4)16-13-17-28(30,5)6)18-22(24(31)34-7)23(29)20-14-11-10-12-15-20/h10-12,14-15,21-23H,8-9,13,16-19H2,1-7H3/t21-,22-,23+/m0/s1 |
| InChIKey | ZOTUCPPBKSXRIJ-RJGXRXQPSA-N |
| XLogP | 4.67 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|