C25H34O6 — CID 122379513
3-O-butyl 1-O,1-O'-diethyl (2S,3R,5R)-2-phenyl-5-prop-1-en-2-ylcyclopentane-1,1,3-tricarboxylate (PubChem CID 122379513) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is 3-O-butyl 1-O,1-O'-diethyl (2S,3R,5R)-2-phenyl-5-prop-1-en-2-ylcyclopentane-1,1,3-tricarboxylate.
| Compound Name | 3-O-butyl 1-O,1-O'-diethyl (2S,3R,5R)-2-phenyl-5-prop-1-en-2-ylcyclopentane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 122379513 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 3-O-butyl 1-O,1-O'-diethyl (2S,3R,5R)-2-phenyl-5-prop-1-en-2-ylcyclopentane-1,1,3-tricarboxylate |
| SMILES | C=C(C)[C@H]1C[C@@H](C(=O)OCCCC)[C@@H](c2ccccc2)C1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C25H34O6/c1-6-9-15-31-22(26)19-16-20(17(4)5)25(23(27)29-7-2,24(28)30-8-3)21(19)18-13-11-10-12-14-18/h10-14,19-21H,4,6-9,15-16H2,1-3,5H3/t19-,20-,21-/m1/s1 |
| InChIKey | ZTSNOJDEOKYMIV-NJDAHSKKSA-N |
| XLogP | 4.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|