C16H21ClO3 — CID 102148590
butyl (2R,4S,6S)-4-chloro-6-phenyloxane-2-carboxylate (PubChem CID 102148590) has the molecular formula C16H21ClO3 and a molecular weight of 296.79 g/mol. Its IUPAC name is butyl (2R,4S,6S)-4-chloro-6-phenyloxane-2-carboxylate.
| Compound Name | butyl (2R,4S,6S)-4-chloro-6-phenyloxane-2-carboxylate |
|---|---|
| PubChem CID | 102148590 |
| Molecular Formula | C16H21ClO3 |
| Molecular Weight | 296.79 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | butyl (2R,4S,6S)-4-chloro-6-phenyloxane-2-carboxylate |
| SMILES | CCCCOC(=O)[C@H]1C[C@@H](Cl)C[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C16H21ClO3/c1-2-3-9-19-16(18)15-11-13(17)10-14(20-15)12-7-5-4-6-8-12/h4-8,13-15H,2-3,9-11H2,1H3/t13-,14-,15+/m0/s1 |
| InChIKey | OATKAYAURWCBOP-SOUVJXGZSA-N |
| XLogP | 3.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.79 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|