C19H20O6 — CID 132539448
dimethyl (4aS,7R,7aR)-3-methyl-1-oxo-7-phenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate (PubChem CID 132539448) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is dimethyl (4aS,7R,7aR)-3-methyl-1-oxo-7-phenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate.
| Compound Name | dimethyl (4aS,7R,7aR)-3-methyl-1-oxo-7-phenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate |
|---|---|
| PubChem CID | 132539448 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | dimethyl (4aS,7R,7aR)-3-methyl-1-oxo-7-phenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H]2C=C(C)OC(=O)[C@H]2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H20O6/c1-11-9-13-10-19(17(21)23-2,18(22)24-3)15(14(13)16(20)25-11)12-7-5-4-6-8-12/h4-9,13-15H,10H2,1-3H3/t13-,14-,15+/m1/s1 |
| InChIKey | DGCYBMAORPJCBE-KFWWJZLASA-N |
| XLogP | 2.20 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|