C31H28O6 — CID 132539449
dibenzyl (4aS,7R,7aR)-3-methyl-1-oxo-7-phenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate (PubChem CID 132539449) has the molecular formula C31H28O6 and a molecular weight of 496.56 g/mol. Its IUPAC name is dibenzyl (4aS,7R,7aR)-3-methyl-1-oxo-7-phenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate.
| Compound Name | dibenzyl (4aS,7R,7aR)-3-methyl-1-oxo-7-phenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate |
|---|---|
| PubChem CID | 132539449 |
| Molecular Formula | C31H28O6 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | dibenzyl (4aS,7R,7aR)-3-methyl-1-oxo-7-phenyl-4a,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate |
| SMILES | CC1=C[C@@H]2CC(C(=O)OCc3ccccc3)(C(=O)OCc3ccccc3)[C@@H](c3ccccc3)[C@@H]2C(=O)O1 |
| InChI | InChI=1S/C31H28O6/c1-21-17-25-18-31(29(33)35-19-22-11-5-2-6-12-22,30(34)36-20-23-13-7-3-8-14-23)27(26(25)28(32)37-21)24-15-9-4-10-16-24/h2-17,25-27H,18-20H2,1H3/t25-,26-,27+/m1/s1 |
| InChIKey | SWARBOFUPLBEAT-PFBJBMPXSA-N |
| XLogP | 5.34 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|