C50H50O4 — CID 132539601
11,22-bis(4-tert-butyl-2,6-dimethoxyphenyl)-8,19-dimethylhexacyclo[10.10.2.02,7.09,23.013,18.020,24]tetracosa-1(23),2,4,6,8,10,12(24),13,15,17,19,21-dodecaene (PubChem CID 132539601) has the molecular formula C50H50O4 and a molecular weight of 714.95 g/mol. Its IUPAC name is 11,22-bis(4-tert-butyl-2,6-dimethoxyphenyl)-8,19-dimethylhexacyclo[10.10.2.02,7.09,23.013,18.020,24]tetracosa-1(23),2,4,6,8,10,12(24),13,15,17,19,21-dodecaene.
| Compound Name | 11,22-bis(4-tert-butyl-2,6-dimethoxyphenyl)-8,19-dimethylhexacyclo[10.10.2.02,7.09,23.013,18.020,24]tetracosa-1(23),2,4,6,8,10,12(24),13,15,17,19,21-dodecaene |
|---|---|
| PubChem CID | 132539601 |
| Molecular Formula | C50H50O4 |
| Molecular Weight | 714.95 g/mol |
| Exact Mass | 714.37 |
| IUPAC Name | 11,22-bis(4-tert-butyl-2,6-dimethoxyphenyl)-8,19-dimethylhexacyclo[10.10.2.02,7.09,23.013,18.020,24]tetracosa-1(23),2,4,6,8,10,12(24),13,15,17,19,21-dodecaene |
| SMILES | COc1cc(C(C)(C)C)cc(OC)c1-c1cc2c(C)c3ccccc3c3c(-c4c(OC)cc(C(C)(C)C)cc4OC)cc4c(C)c5ccccc5c1c4c23 |
| InChI | InChI=1S/C50H50O4/c1-27-31-17-13-15-19-33(31)43-38(46-41(53-11)23-30(50(6,7)8)24-42(46)54-12)26-36-28(2)32-18-14-16-20-34(32)44-37(25-35(27)47(43)48(36)44)45-39(51-9)21-29(49(3,4)5)22-40(45)52-10/h13-26H,1-12H3 |
| InChIKey | VDIBXNYMOLPFOP-UHFFFAOYSA-N |
| XLogP | 13.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.95 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|