C19H21Cl3N2O5S2 — CID 132540243
2,2,2-trichloroethyl N-[(2S,3R)-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidin-3-yl]sulfamate (PubChem CID 132540243) has the molecular formula C19H21Cl3N2O5S2 and a molecular weight of 527.88 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(2S,3R)-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidin-3-yl]sulfamate.
| Compound Name | 2,2,2-trichloroethyl N-[(2S,3R)-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidin-3-yl]sulfamate |
|---|---|
| PubChem CID | 132540243 |
| Molecular Formula | C19H21Cl3N2O5S2 |
| Molecular Weight | 527.88 g/mol |
| Exact Mass | 526.00 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(2S,3R)-1-(4-methylphenyl)sulfonyl-2-phenylpyrrolidin-3-yl]sulfamate |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@@H](NS(=O)(=O)OCC(Cl)(Cl)Cl)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C19H21Cl3N2O5S2/c1-14-7-9-16(10-8-14)30(25,26)24-12-11-17(18(24)15-5-3-2-4-6-15)23-31(27,28)29-13-19(20,21)22/h2-10,17-18,23H,11-13H2,1H3/t17-,18+/m1/s1 |
| InChIKey | DWUVNINBJUUNFR-MSOLQXFVSA-N |
| XLogP | 3.72 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.88 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|