C24H22N2O — CID 132540375
1-[(2S,3S)-2,3-diphenylaziridin-2-yl]-3,3-dimethylindol-2-one (PubChem CID 132540375) has the molecular formula C24H22N2O and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[(2S,3S)-2,3-diphenylaziridin-2-yl]-3,3-dimethylindol-2-one.
| Compound Name | 1-[(2S,3S)-2,3-diphenylaziridin-2-yl]-3,3-dimethylindol-2-one |
|---|---|
| PubChem CID | 132540375 |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-[(2S,3S)-2,3-diphenylaziridin-2-yl]-3,3-dimethylindol-2-one |
| SMILES | CC1(C)C(=O)N([C@]2(c3ccccc3)N[C@H]2c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C24H22N2O/c1-23(2)19-15-9-10-16-20(19)26(22(23)27)24(18-13-7-4-8-14-18)21(25-24)17-11-5-3-6-12-17/h3-16,21,25H,1-2H3/t21-,24-/m0/s1 |
| InChIKey | ZVOOWXXTNYCKHO-URXFXBBRSA-N |
| XLogP | 4.51 |
| TPSA | 42.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|