C14H15N3O2 — CID 132541048
2-ethenyl-1-methylspiro[2,4-dihydroquinoline-3,5'-imidazolidine]-2',4'-dione (PubChem CID 132541048) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-ethenyl-1-methylspiro[2,4-dihydroquinoline-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | 2-ethenyl-1-methylspiro[2,4-dihydroquinoline-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 132541048 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-ethenyl-1-methylspiro[2,4-dihydroquinoline-3,5'-imidazolidine]-2',4'-dione |
| SMILES | C=CC1N(C)c2ccccc2CC12NC(=O)NC2=O |
| InChI | InChI=1S/C14H15N3O2/c1-3-11-14(12(18)15-13(19)16-14)8-9-6-4-5-7-10(9)17(11)2/h3-7,11H,1,8H2,2H3,(H2,15,16,18,19) |
| InChIKey | LNHKVECMHBBJJP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|