C14H14N3O3Y- — CID 58847186
1'-methanidyl-2'-methylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione;yttrium (PubChem CID 58847186) has the molecular formula C14H14N3O3Y- and a molecular weight of 361.19 g/mol. Its IUPAC name is 1'-methanidyl-2'-methylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione;yttrium.
| Compound Name | 1'-methanidyl-2'-methylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione;yttrium |
|---|---|
| PubChem CID | 58847186 |
| Molecular Formula | C14H14N3O3Y- |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 1'-methanidyl-2'-methylspiro[1,3-diazinane-5,3'-2,4-dihydroquinoline]-2,4,6-trione;yttrium |
| SMILES | [CH2-]N1c2ccccc2CC2(C(=O)NC(=O)NC2=O)C1C.[Y] |
| InChI | InChI=1S/C14H14N3O3.Y/c1-8-14(11(18)15-13(20)16-12(14)19)7-9-5-3-4-6-10(9)17(8)2;/h3-6,8H,2,7H2,1H3,(H2,15,16,18,19,20);/q-1; |
| InChIKey | GRTNXKROGJOFMY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|