C16H12O2 — CID 132542773
2-phenyl-2,3-dihydrofuro[2,3-f][1]benzofuran (PubChem CID 132542773) has the molecular formula C16H12O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-phenyl-2,3-dihydrofuro[2,3-f][1]benzofuran.
| Compound Name | 2-phenyl-2,3-dihydrofuro[2,3-f][1]benzofuran |
|---|---|
| PubChem CID | 132542773 |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-phenyl-2,3-dihydrofuro[2,3-f][1]benzofuran |
| SMILES | c1ccc(C2Cc3cc4occc4cc3O2)cc1 |
| InChI | InChI=1S/C16H12O2/c1-2-4-11(5-3-1)15-10-13-9-14-12(6-7-17-14)8-16(13)18-15/h1-9,15H,10H2 |
| InChIKey | GKGFDRFTOVHBPW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |