C13H17BN2O4 — CID 132542904
2-(2-anilinoethyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 132542904) has the molecular formula C13H17BN2O4 and a molecular weight of 276.10 g/mol. Its IUPAC name is 2-(2-anilinoethyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 2-(2-anilinoethyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 132542904 |
| Molecular Formula | C13H17BN2O4 |
| Molecular Weight | 276.10 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-(2-anilinoethyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | CN1CC(=O)OB(CCNc2ccccc2)OC(=O)C1 |
| InChI | InChI=1S/C13H17BN2O4/c1-16-9-12(17)19-14(20-13(18)10-16)7-8-15-11-5-3-2-4-6-11/h2-6,15H,7-10H2,1H3 |
| InChIKey | VUMXAXZGSQPZHK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.10 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|