C26H20Br2 — CID 132543443
7-bromo-9-(4-bromophenyl)-4-(4-methylphenyl)-2,3-dihydro-1H-fluorene (PubChem CID 132543443) has the molecular formula C26H20Br2 and a molecular weight of 492.25 g/mol. Its IUPAC name is 7-bromo-9-(4-bromophenyl)-4-(4-methylphenyl)-2,3-dihydro-1H-fluorene.
| Compound Name | 7-bromo-9-(4-bromophenyl)-4-(4-methylphenyl)-2,3-dihydro-1H-fluorene |
|---|---|
| PubChem CID | 132543443 |
| Molecular Formula | C26H20Br2 |
| Molecular Weight | 492.25 g/mol |
| Exact Mass | 489.99 |
| IUPAC Name | 7-bromo-9-(4-bromophenyl)-4-(4-methylphenyl)-2,3-dihydro-1H-fluorene |
| SMILES | Cc1ccc(C2=C3C(=C(c4ccc(Br)cc4)c4cc(Br)ccc43)CCC2)cc1 |
| InChI | InChI=1S/C26H20Br2/c1-16-5-7-17(8-6-16)21-3-2-4-23-25(18-9-11-19(27)12-10-18)24-15-20(28)13-14-22(24)26(21)23/h5-15H,2-4H2,1H3 |
| InChIKey | SEQLBJZSVWADFN-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.25 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|