C20H40O5Si2 — CID 132544493
1-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]propan-2-one (PubChem CID 132544493) has the molecular formula C20H40O5Si2 and a molecular weight of 416.71 g/mol. Its IUPAC name is 1-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]propan-2-one.
| Compound Name | 1-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]propan-2-one |
|---|---|
| PubChem CID | 132544493 |
| Molecular Formula | C20H40O5Si2 |
| Molecular Weight | 416.71 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 1-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]propan-2-one |
| SMILES | CC(=O)C[C@H]1C[C@@H]2O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC[C@H]2O1 |
| InChI | InChI=1S/C20H40O5Si2/c1-13(2)26(14(3)4)22-12-20-19(11-18(23-20)10-17(9)21)24-27(25-26,15(5)6)16(7)8/h13-16,18-20H,10-12H2,1-9H3/t18-,19-,20+/m0/s1 |
| InChIKey | MOCOAOJEFLYFNA-SLFFLAALSA-N |
| XLogP | 5.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.71 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|