C20H40O6Si2 — CID 132544494
methyl 2-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]acetate (PubChem CID 132544494) has the molecular formula C20H40O6Si2 and a molecular weight of 432.71 g/mol. Its IUPAC name is methyl 2-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]acetate.
| Compound Name | methyl 2-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]acetate |
|---|---|
| PubChem CID | 132544494 |
| Molecular Formula | C20H40O6Si2 |
| Molecular Weight | 432.71 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | methyl 2-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]acetate |
| SMILES | COC(=O)C[C@H]1C[C@@H]2O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC[C@H]2O1 |
| InChI | InChI=1S/C20H40O6Si2/c1-13(2)27(14(3)4)23-12-19-18(10-17(24-19)11-20(21)22-9)25-28(26-27,15(5)6)16(7)8/h13-19H,10-12H2,1-9H3/t17-,18+,19-/m1/s1 |
| InChIKey | GHSZZCMWQNARDS-CEXWTWQISA-N |
| XLogP | 4.66 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.71 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|