C21H48O6Si4 — CID 57337212
1-[(2S,3S,4R,5S,6R)-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]propan-2-one (PubChem CID 57337212) has the molecular formula C21H48O6Si4 and a molecular weight of 508.95 g/mol. Its IUPAC name is 1-[(2S,3S,4R,5S,6R)-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]propan-2-one.
| Compound Name | 1-[(2S,3S,4R,5S,6R)-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 57337212 |
| Molecular Formula | C21H48O6Si4 |
| Molecular Weight | 508.95 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 1-[(2S,3S,4R,5S,6R)-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C21H48O6Si4/c1-16(22)14-17-19(25-29(5,6)7)21(27-31(11,12)13)20(26-30(8,9)10)18(24-17)15-23-28(2,3)4/h17-21H,14-15H2,1-13H3/t17-,18+,19-,20-,21+/m0/s1 |
| InChIKey | MVDRVEARLAUIKL-HGJUEJDCSA-N |
| XLogP | 5.24 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.95 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|